C13H18N2 — CID 142875442
8,8-dimethylpyrido[3,2-b]azepine;ethane (PubChem CID 142875442) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 8,8-dimethylpyrido[3,2-b]azepine;ethane.
| Compound Name | 8,8-dimethylpyrido[3,2-b]azepine;ethane |
|---|---|
| PubChem CID | 142875442 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 8,8-dimethylpyrido[3,2-b]azepine;ethane |
| SMILES | CC.CC1(C)C=CN=c2cccnc2=C1 |
| InChI | InChI=1S/C11H12N2.C2H6/c1-11(2)5-7-13-9-4-3-6-12-10(9)8-11;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | WMJMAWWZGVTWQJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |