C11H20N2 — CID 123210191
(E)-3-N-butan-2-ylidene-1-N-ethylpent-2-ene-1,3-diimine (PubChem CID 123210191) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (E)-3-N-butan-2-ylidene-1-N-ethylpent-2-ene-1,3-diimine.
| Compound Name | (E)-3-N-butan-2-ylidene-1-N-ethylpent-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 123210191 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (E)-3-N-butan-2-ylidene-1-N-ethylpent-2-ene-1,3-diimine |
| SMILES | CC/N=C/C=C(CC)/N=C(\C)CC |
| InChI | InChI=1S/C11H20N2/c1-5-10(4)13-11(6-2)8-9-12-7-3/h8-9H,5-7H2,1-4H3/b11-8+,12-9+,13-10+ |
| InChIKey | DCDLIBCFUMABIQ-FOXWYSRTSA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|