C14H21N — CID 142805224
4a,7-dimethyl-5,6-dihydrocyclohepta[b]pyridine;ethane (PubChem CID 142805224) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4a,7-dimethyl-5,6-dihydrocyclohepta[b]pyridine;ethane.
| Compound Name | 4a,7-dimethyl-5,6-dihydrocyclohepta[b]pyridine;ethane |
|---|---|
| PubChem CID | 142805224 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4a,7-dimethyl-5,6-dihydrocyclohepta[b]pyridine;ethane |
| SMILES | CC.CC1=CC=C2N=CC=CC2(C)CC1 |
| InChI | InChI=1S/C12H15N.C2H6/c1-10-4-5-11-12(2,8-6-10)7-3-9-13-11;1-2/h3-5,7,9H,6,8H2,1-2H3;1-2H3 |
| InChIKey | OZEUGHTWTKZUQX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |