About 4-butyl-4-methylazepine
4-butyl-4-methylazepine (PubChem CID 123402055) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-butyl-4-methylazepine.
Molecular Properties
| Compound Name | 4-butyl-4-methylazepine |
| PubChem CID | 123402055 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-butyl-4-methylazepine |
| SMILES | CCCCC1(C)C=CC=NC=C1 |
| InChI | InChI=1S/C11H17N/c1-3-4-6-11(2)7-5-9-12-10-8-11/h5,7-10H,3-4,6H2,1-2H3 |
| InChIKey | LBYGLFAJUJZYQP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-4-methylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-4-methylazepine?
The IUPAC name of 4-butyl-4-methylazepine (CID 123402055) is 4-butyl-4-methylazepine.
What is the SMILES notation for 4-butyl-4-methylazepine?
The canonical SMILES for 4-butyl-4-methylazepine is CCCCC1(C)C=CC=NC=C1.
What is the InChIKey of 4-butyl-4-methylazepine?
The InChIKey is LBYGLFAJUJZYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-3-4-6-11(2)7-5-9-12-10-8-11/h5,7-10H,3-4,6H2,1-2H3.
What are the key properties of 4-butyl-4-methylazepine?
4-butyl-4-methylazepine has a molecular weight of 163.26 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-4-methylazepine is sourced from PubChem (CID 123402055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).