C12H16N2 — CID 123175766
2-tert-butyl-3,8a-dihydro-1,6-naphthyridine (PubChem CID 123175766) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-tert-butyl-3,8a-dihydro-1,6-naphthyridine.
| Compound Name | 2-tert-butyl-3,8a-dihydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 123175766 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-tert-butyl-3,8a-dihydro-1,6-naphthyridine |
| SMILES | CC(C)(C)C1=NC2C=CN=CC2=CC1 |
| InChI | InChI=1S/C12H16N2/c1-12(2,3)11-5-4-9-8-13-7-6-10(9)14-11/h4,6-8,10H,5H2,1-3H3 |
| InChIKey | KNUQFCUYIYFOKS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |