C15H23N3 — CID 155649396
6,7-ditert-butyl-4,4a-dihydropyrido[3,2-c]pyridazine (PubChem CID 155649396) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 6,7-ditert-butyl-4,4a-dihydropyrido[3,2-c]pyridazine.
| Compound Name | 6,7-ditert-butyl-4,4a-dihydropyrido[3,2-c]pyridazine |
|---|---|
| PubChem CID | 155649396 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 6,7-ditert-butyl-4,4a-dihydropyrido[3,2-c]pyridazine |
| SMILES | CC(C)(C)C1=CC2=NN=CCC2N=C1C(C)(C)C |
| InChI | InChI=1S/C15H23N3/c1-14(2,3)10-9-12-11(7-8-16-18-12)17-13(10)15(4,5)6/h8-9,11H,7H2,1-6H3 |
| InChIKey | BZQAIYULUNTGAD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |