About (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole
(4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole (PubChem CID 123802175) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole.
Molecular Properties
| Compound Name | (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole |
| PubChem CID | 123802175 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole |
| SMILES | C1=NC=C2/C(=C/C3CCCCC3)N=CC12 |
| InChI | InChI=1S/C13H16N2/c1-2-4-10(5-3-1)6-13-12-9-14-7-11(12)8-15-13/h6-11H,1-5H2/b13-6- |
| InChIKey | LSZXWOASWXNTJP-MLPAPPSSSA-N |
| XLogP | 3.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole?
The IUPAC name of (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole (CID 123802175) is (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole.
What is the SMILES notation for (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole?
The canonical SMILES for (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole is C1=NC=C2/C(=C/C3CCCCC3)N=CC12.
What is the InChIKey of (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole?
The InChIKey is LSZXWOASWXNTJP-MLPAPPSSSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-4-10(5-3-1)6-13-12-9-14-7-11(12)8-15-13/h6-11H,1-5H2/b13-6-.
What are the key properties of (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole?
(4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole has a molecular weight of 200.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(cyclohexylmethylidene)-6aH-pyrrolo[3,4-c]pyrrole is sourced from PubChem (CID 123802175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).