C20H27N3 — CID 143756251
(Z)-2-[7-(cyclohexylmethyl)-3aH-pyrrolo[2,3-c]pyridin-3-yl]-N-ethylbut-2-en-1-imine (PubChem CID 143756251) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is (Z)-2-[7-(cyclohexylmethyl)-3aH-pyrrolo[2,3-c]pyridin-3-yl]-N-ethylbut-2-en-1-imine.
| Compound Name | (Z)-2-[7-(cyclohexylmethyl)-3aH-pyrrolo[2,3-c]pyridin-3-yl]-N-ethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 143756251 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | (Z)-2-[7-(cyclohexylmethyl)-3aH-pyrrolo[2,3-c]pyridin-3-yl]-N-ethylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\CC)C1=CN=C2C(CC3CCCCC3)=NC=CC12 |
| InChI | InChI=1S/C20H27N3/c1-3-16(13-21-4-2)18-14-23-20-17(18)10-11-22-19(20)12-15-8-6-5-7-9-15/h3,10-11,13-15,17H,4-9,12H2,1-2H3/b16-3+,21-13+ |
| InChIKey | GYHYHSDSIRMZHO-VGIXHXRSSA-N |
| XLogP | 4.92 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|