C18H31N — CID 139332369
(3Z)-6-butyl-N-ethenyldodeca-1,3-dien-5-imine (PubChem CID 139332369) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (3Z)-6-butyl-N-ethenyldodeca-1,3-dien-5-imine.
| Compound Name | (3Z)-6-butyl-N-ethenyldodeca-1,3-dien-5-imine |
|---|---|
| PubChem CID | 139332369 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (3Z)-6-butyl-N-ethenyldodeca-1,3-dien-5-imine |
| SMILES | C=C/C=C\C(=N/C=C)C(CCCC)CCCCCC |
| InChI | InChI=1S/C18H31N/c1-5-9-12-13-15-17(14-10-6-2)18(19-8-4)16-11-7-3/h7-8,11,16-17H,3-6,9-10,12-15H2,1-2H3/b16-11-,19-18+ |
| InChIKey | JEOVCRHNFDTCSX-QOOZPXINSA-N |
| XLogP | 6.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|