C30H48N2 — CID 143721949
ethane;N-[(5Z,6Z,8Z)-3-methylidene-5-[4-methyl-3-(methyliminomethyl)pent-3-en-2-ylidene]deca-1,6,8-trien-2-yl]-1-prop-2-enylcyclohexan-1-amine (PubChem CID 143721949) has the molecular formula C30H48N2 and a molecular weight of 436.73 g/mol. Its IUPAC name is ethane;N-[(5Z,6Z,8Z)-3-methylidene-5-[4-methyl-3-(methyliminomethyl)pent-3-en-2-ylidene]deca-1,6,8-trien-2-yl]-1-prop-2-enylcyclohexan-1-amine.
| Compound Name | ethane;N-[(5Z,6Z,8Z)-3-methylidene-5-[4-methyl-3-(methyliminomethyl)pent-3-en-2-ylidene]deca-1,6,8-trien-2-yl]-1-prop-2-enylcyclohexan-1-amine |
|---|---|
| PubChem CID | 143721949 |
| Molecular Formula | C30H48N2 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.38 |
| IUPAC Name | ethane;N-[(5Z,6Z,8Z)-3-methylidene-5-[4-methyl-3-(methyliminomethyl)pent-3-en-2-ylidene]deca-1,6,8-trien-2-yl]-1-prop-2-enylcyclohexan-1-amine |
| SMILES | C=CCC1(NC(=C)C(=C)CC(/C=C\C=C/C)=C(\C)C(/C=N/C)=C(C)C)CCCCC1.CC |
| InChI | InChI=1S/C28H42N2.C2H6/c1-9-11-13-16-26(24(6)27(21-29-8)22(3)4)20-23(5)25(7)30-28(17-10-2)18-14-12-15-19-28;1-2/h9-11,13,16,21,30H,2,5,7,12,14-15,17-20H2,1,3-4,6,8H3;1-2H3/b11-9-,16-13-,26-24+,29-21+; |
| InChIKey | DJRNTAFJOUUBHF-WDWZNQNCSA-N |
| XLogP | 8.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|