C28H54N2 — CID 143683651
4-butyl-N-[(3Z)-hexa-3,5-dienyl]cyclohexan-1-amine;ethane;N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine (PubChem CID 143683651) has the molecular formula C28H54N2 and a molecular weight of 418.75 g/mol. Its IUPAC name is 4-butyl-N-[(3Z)-hexa-3,5-dienyl]cyclohexan-1-amine;ethane;N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine.
| Compound Name | 4-butyl-N-[(3Z)-hexa-3,5-dienyl]cyclohexan-1-amine;ethane;N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 143683651 |
| Molecular Formula | C28H54N2 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 418.43 |
| IUPAC Name | 4-butyl-N-[(3Z)-hexa-3,5-dienyl]cyclohexan-1-amine;ethane;N-[(3Z)-2-methylpenta-1,3-dien-3-yl]ethanimine |
| SMILES | C=C(C)C(=C/C)/N=C/C.C=C/C=C\CCNC1CCC(CCCC)CC1.CC.CC |
| InChI | InChI=1S/C16H29N.C8H13N.2C2H6/c1-3-5-7-8-14-17-16-12-10-15(11-13-16)9-6-4-2;1-5-8(7(3)4)9-6-2;2*1-2/h3,5,7,15-17H,1,4,6,8-14H2,2H3;5-6H,3H2,1-2,4H3;2*1-2H3/b7-5-;8-5-,9-6+;; |
| InChIKey | IXSPVHRJROSDRU-BXGLSHRESA-N |
| XLogP | 9.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|