C25H33N3 — CID 143722122
N-[1-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrrol-2-yl]ethenyl]-1-prop-2-enylcyclohexan-1-amine (PubChem CID 143722122) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is N-[1-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrrol-2-yl]ethenyl]-1-prop-2-enylcyclohexan-1-amine.
| Compound Name | N-[1-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrrol-2-yl]ethenyl]-1-prop-2-enylcyclohexan-1-amine |
|---|---|
| PubChem CID | 143722122 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-[1-[5-[(3E)-5-iminopenta-1,3-dien-3-yl]-4-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrrol-2-yl]ethenyl]-1-prop-2-enylcyclohexan-1-amine |
| SMILES | [H]/N=C/C=C(\C=C)C1=C(/C=C\C=C/C)CC(C(=C)NC2(CC=C)CCCCC2)=N1 |
| InChI | InChI=1S/C25H33N3/c1-5-8-10-13-22-19-23(27-24(22)21(7-3)14-18-26)20(4)28-25(15-6-2)16-11-9-12-17-25/h5-8,10,13-14,18,26,28H,2-4,9,11-12,15-17,19H2,1H3/b8-5-,13-10-,21-14+,26-18+ |
| InChIKey | QXHCIHIKMXPQPI-FSBATMMESA-N |
| XLogP | 6.36 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|