C28H39N3 — CID 143757134
N-(3-heptan-4-ylcyclopenta-1,3-dien-1-yl)-3-[(Z)-1-propyliminobut-2-en-2-yl]-5a,6-dihydro-3aH-cyclopropa[g]indol-6a-amine (PubChem CID 143757134) has the molecular formula C28H39N3 and a molecular weight of 417.64 g/mol. Its IUPAC name is N-(3-heptan-4-ylcyclopenta-1,3-dien-1-yl)-3-[(Z)-1-propyliminobut-2-en-2-yl]-5a,6-dihydro-3aH-cyclopropa[g]indol-6a-amine.
| Compound Name | N-(3-heptan-4-ylcyclopenta-1,3-dien-1-yl)-3-[(Z)-1-propyliminobut-2-en-2-yl]-5a,6-dihydro-3aH-cyclopropa[g]indol-6a-amine |
|---|---|
| PubChem CID | 143757134 |
| Molecular Formula | C28H39N3 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | N-(3-heptan-4-ylcyclopenta-1,3-dien-1-yl)-3-[(Z)-1-propyliminobut-2-en-2-yl]-5a,6-dihydro-3aH-cyclopropa[g]indol-6a-amine |
| SMILES | C/C=C(\C=N\CCC)C1=CN=C2C1C=CC1CC21NC1=CC(C(CCC)CCC)=CC1 |
| InChI | InChI=1S/C28H39N3/c1-5-9-21(10-6-2)22-11-13-24(16-22)31-28-17-23(28)12-14-25-26(19-30-27(25)28)20(8-4)18-29-15-7-3/h8,11-12,14,16,18-19,21,23,25,31H,5-7,9-10,13,15,17H2,1-4H3/b20-8+,29-18+ |
| InChIKey | HVUSJLZTCHDHDB-ONHAKBJDSA-N |
| XLogP | 6.72 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|