C29H37N3 — CID 143756549
ethane;5-[(Z)-1-ethyliminobut-2-en-2-yl]-N-(3-methyl-2,3-dihydronaphthalen-1-yl)-1,1a,3a,4-tetrahydrocyclopropa[h]quinolin-7b-amine (PubChem CID 143756549) has the molecular formula C29H37N3 and a molecular weight of 427.64 g/mol. Its IUPAC name is ethane;5-[(Z)-1-ethyliminobut-2-en-2-yl]-N-(3-methyl-2,3-dihydronaphthalen-1-yl)-1,1a,3a,4-tetrahydrocyclopropa[h]quinolin-7b-amine.
| Compound Name | ethane;5-[(Z)-1-ethyliminobut-2-en-2-yl]-N-(3-methyl-2,3-dihydronaphthalen-1-yl)-1,1a,3a,4-tetrahydrocyclopropa[h]quinolin-7b-amine |
|---|---|
| PubChem CID | 143756549 |
| Molecular Formula | C29H37N3 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.30 |
| IUPAC Name | ethane;5-[(Z)-1-ethyliminobut-2-en-2-yl]-N-(3-methyl-2,3-dihydronaphthalen-1-yl)-1,1a,3a,4-tetrahydrocyclopropa[h]quinolin-7b-amine |
| SMILES | C/C=C(\C=N\CC)C1=CN=C2C(C=CC3CC23NC2=c3ccccc3=CC(C)C2)C1.CC |
| InChI | InChI=1S/C27H31N3.C2H6/c1-4-19(16-28-5-2)22-14-21-10-11-23-15-27(23,26(21)29-17-22)30-25-13-18(3)12-20-8-6-7-9-24(20)25;1-2/h4,6-12,16-18,21,23,30H,5,13-15H2,1-3H3;1-2H3/b19-4+,28-16+; |
| InChIKey | ICEYRONIEYMRIR-ADDNOGCVSA-N |
| XLogP | 4.94 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|