C25H25N3 — CID 143757185
N-(8H-benzo[7]annulen-9-yl)-3-[(Z)-1-methyliminobut-2-en-2-yl]-4,4a-dihydroquinolin-8-amine (PubChem CID 143757185) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-(8H-benzo[7]annulen-9-yl)-3-[(Z)-1-methyliminobut-2-en-2-yl]-4,4a-dihydroquinolin-8-amine.
| Compound Name | N-(8H-benzo[7]annulen-9-yl)-3-[(Z)-1-methyliminobut-2-en-2-yl]-4,4a-dihydroquinolin-8-amine |
|---|---|
| PubChem CID | 143757185 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-(8H-benzo[7]annulen-9-yl)-3-[(Z)-1-methyliminobut-2-en-2-yl]-4,4a-dihydroquinolin-8-amine |
| SMILES | C/C=C(\C=N\C)C1=CN=C2C(NC3=c4ccccc4=CC=CC3)=CC=CC2C1 |
| InChI | InChI=1S/C25H25N3/c1-3-18(16-26-2)21-15-20-11-8-14-24(25(20)27-17-21)28-23-13-7-5-10-19-9-4-6-12-22(19)23/h3-12,14,16-17,20,28H,13,15H2,1-2H3/b18-3+,26-16+ |
| InChIKey | IFPDPEJKQVGASR-LCJHETDPSA-N |
| XLogP | 3.57 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|