C20H34N2 — CID 167169105
(Z,5Z)-4-ethyl-6-methylidene-9-methylimino-5-(2-methylpropylidene)-N-prop-1-en-2-ylnon-7-en-1-amine (PubChem CID 167169105) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (Z,5Z)-4-ethyl-6-methylidene-9-methylimino-5-(2-methylpropylidene)-N-prop-1-en-2-ylnon-7-en-1-amine.
| Compound Name | (Z,5Z)-4-ethyl-6-methylidene-9-methylimino-5-(2-methylpropylidene)-N-prop-1-en-2-ylnon-7-en-1-amine |
|---|---|
| PubChem CID | 167169105 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (Z,5Z)-4-ethyl-6-methylidene-9-methylimino-5-(2-methylpropylidene)-N-prop-1-en-2-ylnon-7-en-1-amine |
| SMILES | C=C(C)NCCCC(CC)/C(=C/C(C)C)C(=C)/C=C\C=N\C |
| InChI | InChI=1S/C20H34N2/c1-8-19(12-10-14-22-17(4)5)20(15-16(2)3)18(6)11-9-13-21-7/h9,11,13,15-16,19,22H,4,6,8,10,12,14H2,1-3,5,7H3/b11-9-,20-15+,21-13+ |
| InChIKey | FLKYGAGBYZNOLQ-KXMDIWMCSA-N |
| XLogP | 5.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|