C13H27N3 — CID 142548250
1-N-(1-aminoethenyl)-4-N-(2,3-dimethylbut-3-en-2-yl)pentane-1,4-diamine (PubChem CID 142548250) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-N-(1-aminoethenyl)-4-N-(2,3-dimethylbut-3-en-2-yl)pentane-1,4-diamine.
| Compound Name | 1-N-(1-aminoethenyl)-4-N-(2,3-dimethylbut-3-en-2-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 142548250 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 1-N-(1-aminoethenyl)-4-N-(2,3-dimethylbut-3-en-2-yl)pentane-1,4-diamine |
| SMILES | C=C(N)NCCCC(C)NC(C)(C)C(=C)C |
| InChI | InChI=1S/C13H27N3/c1-10(2)13(5,6)16-11(3)8-7-9-15-12(4)14/h11,15-16H,1,4,7-9,14H2,2-3,5-6H3 |
| InChIKey | OBNORAQTVRXTOR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|