C11H26BN3O3 — CID 91037943
N-[(3S)-6-(1-aminoethenylamino)-2-oxohexan-3-yl]-methylboronamidic acid;ethanol (PubChem CID 91037943) has the molecular formula C11H26BN3O3 and a molecular weight of 259.16 g/mol. Its IUPAC name is N-[(3S)-6-(1-aminoethenylamino)-2-oxohexan-3-yl]-methylboronamidic acid;ethanol.
| Compound Name | N-[(3S)-6-(1-aminoethenylamino)-2-oxohexan-3-yl]-methylboronamidic acid;ethanol |
|---|---|
| PubChem CID | 91037943 |
| Molecular Formula | C11H26BN3O3 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | N-[(3S)-6-(1-aminoethenylamino)-2-oxohexan-3-yl]-methylboronamidic acid;ethanol |
| SMILES | C=C(N)NCCC[C@H](NB(C)O)C(C)=O.CCO |
| InChI | InChI=1S/C9H20BN3O2.C2H6O/c1-7(14)9(13-10(3)15)5-4-6-12-8(2)11;1-2-3/h9,12-13,15H,2,4-6,11H2,1,3H3;3H,2H2,1H3/t9-;/m0./s1 |
| InChIKey | SKRXBKRKUGIMEC-FVGYRXGTSA-N |
| XLogP | -0.56 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|