C14H30N4O3 — CID 155015190
[4-[[2-(ethylamino)-1-hydroxy-3-methylbutyl]amino]-5-oxohexyl]urea (PubChem CID 155015190) has the molecular formula C14H30N4O3 and a molecular weight of 302.42 g/mol. Its IUPAC name is [4-[[2-(ethylamino)-1-hydroxy-3-methylbutyl]amino]-5-oxohexyl]urea.
| Compound Name | [4-[[2-(ethylamino)-1-hydroxy-3-methylbutyl]amino]-5-oxohexyl]urea |
|---|---|
| PubChem CID | 155015190 |
| Molecular Formula | C14H30N4O3 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | [4-[[2-(ethylamino)-1-hydroxy-3-methylbutyl]amino]-5-oxohexyl]urea |
| SMILES | CCNC(C(C)C)C(O)NC(CCCNC(N)=O)C(C)=O |
| InChI | InChI=1S/C14H30N4O3/c1-5-16-12(9(2)3)13(20)18-11(10(4)19)7-6-8-17-14(15)21/h9,11-13,16,18,20H,5-8H2,1-4H3,(H3,15,17,21) |
| InChIKey | IWNJDYGHBDSMJW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|