C13H26N2 — CID 170024058
1-N-but-1-en-2-yl-6-methyl-5-methylideneheptane-1,4-diamine (PubChem CID 170024058) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-N-but-1-en-2-yl-6-methyl-5-methylideneheptane-1,4-diamine.
| Compound Name | 1-N-but-1-en-2-yl-6-methyl-5-methylideneheptane-1,4-diamine |
|---|---|
| PubChem CID | 170024058 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-N-but-1-en-2-yl-6-methyl-5-methylideneheptane-1,4-diamine |
| SMILES | C=C(CC)NCCCC(N)C(=C)C(C)C |
| InChI | InChI=1S/C13H26N2/c1-6-11(4)15-9-7-8-13(14)12(5)10(2)3/h10,13,15H,4-9,14H2,1-3H3 |
| InChIKey | PIPGVCCHMZKIRH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|