About N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen
N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen (PubChem CID 156747368) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen |
| PubChem CID | 156747368 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen |
| SMILES | C=C(CC)NCCCCCCOC(C)C.[H][H] |
| InChI | InChI=1S/C13H27NO.H2/c1-5-13(4)14-10-8-6-7-9-11-15-12(2)3;/h12,14H,4-11H2,1-3H3;1H |
| InChIKey | YBUIKIRXSTXQDV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen?
The IUPAC name of N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen (CID 156747368) is N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen.
What is the SMILES notation for N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen?
The canonical SMILES for N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen is C=C(CC)NCCCCCCOC(C)C.[H][H].
What is the InChIKey of N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen?
The InChIKey is YBUIKIRXSTXQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO.H2/c1-5-13(4)14-10-8-6-7-9-11-15-12(2)3;/h12,14H,4-11H2,1-3H3;1H.
What are the key properties of N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen?
N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen has a molecular weight of 215.38 g/mol, XLogP of 3.73, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-6-propan-2-yloxyhexan-1-amine;molecular hydrogen is sourced from PubChem (CID 156747368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).