C13H27NO3V — CID 154671854
2-hydroxy-N-(8-propan-2-yloxyoctyl)acetamide;vanadium (PubChem CID 154671854) has the molecular formula C13H27NO3V and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-hydroxy-N-(8-propan-2-yloxyoctyl)acetamide;vanadium.
| Compound Name | 2-hydroxy-N-(8-propan-2-yloxyoctyl)acetamide;vanadium |
|---|---|
| PubChem CID | 154671854 |
| Molecular Formula | C13H27NO3V |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-hydroxy-N-(8-propan-2-yloxyoctyl)acetamide;vanadium |
| SMILES | CC(C)OCCCCCCCCNC(=O)CO.[V] |
| InChI | InChI=1S/C13H27NO3.V/c1-12(2)17-10-8-6-4-3-5-7-9-14-13(16)11-15;/h12,15H,3-11H2,1-2H3,(H,14,16); |
| InChIKey | VIQJOOOZSRCSCB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|