C19H40N2 — CID 170194106
5,8-diethyl-9-N,9-N-dimethyl-1-N-prop-1-en-2-yldecane-1,9-diamine (PubChem CID 170194106) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 5,8-diethyl-9-N,9-N-dimethyl-1-N-prop-1-en-2-yldecane-1,9-diamine.
| Compound Name | 5,8-diethyl-9-N,9-N-dimethyl-1-N-prop-1-en-2-yldecane-1,9-diamine |
|---|---|
| PubChem CID | 170194106 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 5,8-diethyl-9-N,9-N-dimethyl-1-N-prop-1-en-2-yldecane-1,9-diamine |
| SMILES | C=C(C)NCCCCC(CC)CCC(CC)C(C)N(C)C |
| InChI | InChI=1S/C19H40N2/c1-8-18(12-10-11-15-20-16(3)4)13-14-19(9-2)17(5)21(6)7/h17-20H,3,8-15H2,1-2,4-7H3 |
| InChIKey | YMEDIZKSVUIFQV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|