C23H45N — CID 146647512
3-ethyl-8-methyl-N-[1-(2,2,4,4-tetramethylcyclopentyl)ethenyl]nonan-1-amine (PubChem CID 146647512) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is 3-ethyl-8-methyl-N-[1-(2,2,4,4-tetramethylcyclopentyl)ethenyl]nonan-1-amine.
| Compound Name | 3-ethyl-8-methyl-N-[1-(2,2,4,4-tetramethylcyclopentyl)ethenyl]nonan-1-amine |
|---|---|
| PubChem CID | 146647512 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | 3-ethyl-8-methyl-N-[1-(2,2,4,4-tetramethylcyclopentyl)ethenyl]nonan-1-amine |
| SMILES | C=C(NCCC(CC)CCCCC(C)C)C1CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C23H45N/c1-9-20(13-11-10-12-18(2)3)14-15-24-19(4)21-16-22(5,6)17-23(21,7)8/h18,20-21,24H,4,9-17H2,1-3,5-8H3 |
| InChIKey | GOBIQFUXPDGZQT-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|