C20H38N2 — CID 156732364
(2Z,4E)-N-ethyl-2-(ethylideneamino)-5,6,6,8,8,9-hexamethyldeca-2,4-dien-1-amine (PubChem CID 156732364) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is (2Z,4E)-N-ethyl-2-(ethylideneamino)-5,6,6,8,8,9-hexamethyldeca-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-N-ethyl-2-(ethylideneamino)-5,6,6,8,8,9-hexamethyldeca-2,4-dien-1-amine |
|---|---|
| PubChem CID | 156732364 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | (2Z,4E)-N-ethyl-2-(ethylideneamino)-5,6,6,8,8,9-hexamethyldeca-2,4-dien-1-amine |
| SMILES | C/C=N/C(=C\C=C(/C)C(C)(C)CC(C)(C)C(C)C)CNCC |
| InChI | InChI=1S/C20H38N2/c1-10-21-14-18(22-11-2)13-12-17(5)20(8,9)15-19(6,7)16(3)4/h11-13,16,21H,10,14-15H2,1-9H3/b17-12+,18-13-,22-11+ |
| InChIKey | ZXNFNKAKYHWOAQ-ZPBLKYKNSA-N |
| XLogP | 5.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|