C19H33N3 — CID 143346049
acetonitrile;3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine (PubChem CID 143346049) has the molecular formula C19H33N3 and a molecular weight of 303.49 g/mol. Its IUPAC name is acetonitrile;3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine.
| Compound Name | acetonitrile;3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143346049 |
| Molecular Formula | C19H33N3 |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.27 |
| IUPAC Name | acetonitrile;3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
| SMILES | C=C(N)C/N=C(C)/C=C/CCCC(C)C(C)/C=C\C.CC#N |
| InChI | InChI=1S/C17H30N2.C2H3N/c1-6-10-14(2)15(3)11-8-7-9-12-17(5)19-13-16(4)18;1-2-3/h6,9-10,12,14-15H,4,7-8,11,13,18H2,1-3,5H3;1H3/b10-6-,12-9+,19-17+; |
| InChIKey | NVKYUORWIDVRHY-SIWKHAIZSA-N |
| XLogP | 5.02 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|