C17H30N2 — CID 143346050
3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine (PubChem CID 143346050) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine.
| Compound Name | 3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143346050 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 3-[[(3E,10Z)-8,9-dimethyldodeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
| SMILES | C=C(N)C/N=C(C)/C=C/CCCC(C)C(C)/C=C\C |
| InChI | InChI=1S/C17H30N2/c1-6-10-14(2)15(3)11-8-7-9-12-17(5)19-13-16(4)18/h6,9-10,12,14-15H,4,7-8,11,13,18H2,1-3,5H3/b10-6-,12-9+,19-17+ |
| InChIKey | NSNIWVNAJORJHA-DQJOAMEQSA-N |
| XLogP | 4.49 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|