C16H26N2 — CID 143346158
3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine (PubChem CID 143346158) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine.
| Compound Name | 3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
|---|---|
| PubChem CID | 143346158 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3-[[(3E)-8-methyl-9-methylideneundeca-3,10-dien-2-ylidene]amino]prop-1-en-2-amine |
| SMILES | C=CC(=C)C(C)CCC/C=C/C(C)=N/CC(=C)N |
| InChI | InChI=1S/C16H26N2/c1-6-13(2)14(3)10-8-7-9-11-16(5)18-12-15(4)17/h6,9,11,14H,1-2,4,7-8,10,12,17H2,3,5H3/b11-9+,18-16+ |
| InChIKey | ZMWZGNKJXKLAOC-GEFYFZSISA-N |
| XLogP | 4.02 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|