C19H28FN3 — CID 135233214
(E)-N-but-1-en-2-yl-5-(3-fluoro-5-imino-4-propanimidoylcyclohexa-1,3-dien-1-yl)hex-1-en-1-amine (PubChem CID 135233214) has the molecular formula C19H28FN3 and a molecular weight of 317.40 g/mol. Its IUPAC name is (E)-N-but-1-en-2-yl-5-(3-fluoro-5-imino-4-propanimidoylcyclohexa-1,3-dien-1-yl)hex-1-en-1-amine.
| Compound Name | (E)-N-but-1-en-2-yl-5-(3-fluoro-5-imino-4-propanimidoylcyclohexa-1,3-dien-1-yl)hex-1-en-1-amine |
|---|---|
| PubChem CID | 135233214 |
| Molecular Formula | C19H28FN3 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | (E)-N-but-1-en-2-yl-5-(3-fluoro-5-imino-4-propanimidoylcyclohexa-1,3-dien-1-yl)hex-1-en-1-amine |
| SMILES | CCC(=C)N/C=C/CCC(C)C1=CC(=C(C(=N)C1)C(=N)CC)F |
| InChI | InChI=1S/C19H28FN3/c1-5-14(4)23-10-8-7-9-13(3)15-11-16(20)19(17(21)6-2)18(22)12-15/h8,10-11,13,21-23H,4-7,9,12H2,1-3H3/b10-8+,21-17?,22-18? |
| InChIKey | XRXPTOWSRPJCCM-OXCUFXOASA-N |
| XLogP | 4.10 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | 567 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|