C24H41N3 — CID 142376834
3-tert-butyl-6-pentylcyclohepta-1,3,5-trien-1-amine;ethane;6-iminocyclohexa-2,4-dien-1-amine (PubChem CID 142376834) has the molecular formula C24H41N3 and a molecular weight of 371.61 g/mol. Its IUPAC name is 3-tert-butyl-6-pentylcyclohepta-1,3,5-trien-1-amine;ethane;6-iminocyclohexa-2,4-dien-1-amine.
| Compound Name | 3-tert-butyl-6-pentylcyclohepta-1,3,5-trien-1-amine;ethane;6-iminocyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142376834 |
| Molecular Formula | C24H41N3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.33 |
| IUPAC Name | 3-tert-butyl-6-pentylcyclohepta-1,3,5-trien-1-amine;ethane;6-iminocyclohexa-2,4-dien-1-amine |
| SMILES | CC.CCCCCC1=CC=C(C(C)(C)C)C=C(N)C1.[H]/N=C1\C=CC=CC1N |
| InChI | InChI=1S/C16H27N.C6H8N2.C2H6/c1-5-6-7-8-13-9-10-14(16(2,3)4)12-15(17)11-13;7-5-3-1-2-4-6(5)8;1-2/h9-10,12H,5-8,11,17H2,1-4H3;1-5,8H,7H2;1-2H3/b;8-6+; |
| InChIKey | JCFVMNHQSUJTFS-MMVXAHOZSA-N |
| XLogP | 6.20 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|