C22H40N4 — CID 166548544
(Z,1E)-1-[(5E)-5-ethylidene-3,6-dimethylpyridazin-4-ylidene]-N-methylpent-2-en-2-amine;octan-3-amine (PubChem CID 166548544) has the molecular formula C22H40N4 and a molecular weight of 360.59 g/mol. Its IUPAC name is (Z,1E)-1-[(5E)-5-ethylidene-3,6-dimethylpyridazin-4-ylidene]-N-methylpent-2-en-2-amine;octan-3-amine.
| Compound Name | (Z,1E)-1-[(5E)-5-ethylidene-3,6-dimethylpyridazin-4-ylidene]-N-methylpent-2-en-2-amine;octan-3-amine |
|---|---|
| PubChem CID | 166548544 |
| Molecular Formula | C22H40N4 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.33 |
| IUPAC Name | (Z,1E)-1-[(5E)-5-ethylidene-3,6-dimethylpyridazin-4-ylidene]-N-methylpent-2-en-2-amine;octan-3-amine |
| SMILES | C/C=c1\c(C)nnc(C)\c1=C\C(=C\CC)NC.CCCCCC(N)CC |
| InChI | InChI=1S/C14H21N3.C8H19N/c1-6-8-12(15-5)9-14-11(4)17-16-10(3)13(14)7-2;1-3-5-6-7-8(9)4-2/h7-9,15H,6H2,1-5H3;8H,3-7,9H2,1-2H3/b12-8-,13-7+,14-9-; |
| InChIKey | ATOAAQMNUWZLKH-NXZIGLIOSA-N |
| XLogP | 3.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|