C22H42N2 — CID 59120187
N-butyl-4-(2-pentyliminopropylidene)dec-2-en-2-amine (PubChem CID 59120187) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is N-butyl-4-(2-pentyliminopropylidene)dec-2-en-2-amine.
| Compound Name | N-butyl-4-(2-pentyliminopropylidene)dec-2-en-2-amine |
|---|---|
| PubChem CID | 59120187 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | N-butyl-4-(2-pentyliminopropylidene)dec-2-en-2-amine |
| SMILES | CCCCCCC(=C/C(C)=N/CCCCC)C=C(C)NCCCC |
| InChI | InChI=1S/C22H42N2/c1-6-9-12-13-15-22(18-20(4)23-16-11-8-3)19-21(5)24-17-14-10-7-2/h18-19,23H,6-17H2,1-5H3/b20-18?,22-19?,24-21+ |
| InChIKey | LWZGHYCBHXGHFY-DIKMANMWSA-N |
| XLogP | 6.83 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|