C13H25N2+ — CID 59120193
[6-(ethylamino)-4-propylhepta-3,5-dien-2-ylidene]-methylazanium (PubChem CID 59120193) has the molecular formula C13H25N2+ and a molecular weight of 209.36 g/mol. Its IUPAC name is [6-(ethylamino)-4-propylhepta-3,5-dien-2-ylidene]-methylazanium.
| Compound Name | [6-(ethylamino)-4-propylhepta-3,5-dien-2-ylidene]-methylazanium |
|---|---|
| PubChem CID | 59120193 |
| Molecular Formula | C13H25N2+ |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | [6-(ethylamino)-4-propylhepta-3,5-dien-2-ylidene]-methylazanium |
| SMILES | CCCC(=C/C(C)=[NH+]/C)C=C(C)NCC |
| InChI | InChI=1S/C13H24N2/c1-6-8-13(9-11(3)14-5)10-12(4)15-7-2/h9-10,15H,6-8H2,1-5H3/p+1/b12-10?,13-9?,14-11+ |
| InChIKey | FBWALUVZOFPVJZ-IQLAQNATSA-O |
| XLogP | 1.40 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|