C18H30N2 — CID 54531433
N,4,5,6,7,8-hexamethyl-10-methyliminoundeca-2,4,6,8-tetraen-2-amine (PubChem CID 54531433) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N,4,5,6,7,8-hexamethyl-10-methyliminoundeca-2,4,6,8-tetraen-2-amine.
| Compound Name | N,4,5,6,7,8-hexamethyl-10-methyliminoundeca-2,4,6,8-tetraen-2-amine |
|---|---|
| PubChem CID | 54531433 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N,4,5,6,7,8-hexamethyl-10-methyliminoundeca-2,4,6,8-tetraen-2-amine |
| SMILES | C/N=C(\C)C=C(C)C(C)=C(C)C(C)=C(C)C=C(C)NC |
| InChI | InChI=1S/C18H30N2/c1-12(10-14(3)19-8)16(5)18(7)17(6)13(2)11-15(4)20-9/h10-11,19H,1-9H3/b13-11?,14-10?,16-12?,18-17?,20-15+ |
| InChIKey | YWVJTWNHTBUDFW-LOJQZSAQSA-N |
| XLogP | 4.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|