C19H31N — CID 59958461
(10Z)-N,4,5,6,7,8,10-heptamethyldodeca-2,4,6,8,10-pentaen-2-amine (PubChem CID 59958461) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (10Z)-N,4,5,6,7,8,10-heptamethyldodeca-2,4,6,8,10-pentaen-2-amine.
| Compound Name | (10Z)-N,4,5,6,7,8,10-heptamethyldodeca-2,4,6,8,10-pentaen-2-amine |
|---|---|
| PubChem CID | 59958461 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (10Z)-N,4,5,6,7,8,10-heptamethyldodeca-2,4,6,8,10-pentaen-2-amine |
| SMILES | C/C=C(/C)C=C(C)C(C)=C(C)C(C)=C(C)C=C(C)NC |
| InChI | InChI=1S/C19H31N/c1-10-13(2)11-14(3)17(6)19(8)18(7)15(4)12-16(5)20-9/h10-12,20H,1-9H3/b13-10-,14-11?,16-12?,18-15?,19-17? |
| InChIKey | NCNVKVMLBHJSOD-BKIHKSGCSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|