C11H16FN — CID 139402965
(3E,5Z)-5-ethenyl-2-fluoro-N-methylocta-3,5,7-trien-3-amine (PubChem CID 139402965) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (3E,5Z)-5-ethenyl-2-fluoro-N-methylocta-3,5,7-trien-3-amine.
| Compound Name | (3E,5Z)-5-ethenyl-2-fluoro-N-methylocta-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 139402965 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (3E,5Z)-5-ethenyl-2-fluoro-N-methylocta-3,5,7-trien-3-amine |
| SMILES | C=C/C=C(C=C)\C=C(\NC)C(C)F |
| InChI | InChI=1S/C11H16FN/c1-5-7-10(6-2)8-11(13-4)9(3)12/h5-9,13H,1-2H2,3-4H3/b10-7-,11-8+ |
| InChIKey | PTSVZBYUGLVUDB-BDLVGCLISA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|