C10H16FN — CID 146521727
(3E,4E)-N-ethyl-3-ethylidene-5-fluorohexa-1,4-dien-2-amine (PubChem CID 146521727) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (3E,4E)-N-ethyl-3-ethylidene-5-fluorohexa-1,4-dien-2-amine.
| Compound Name | (3E,4E)-N-ethyl-3-ethylidene-5-fluorohexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 146521727 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (3E,4E)-N-ethyl-3-ethylidene-5-fluorohexa-1,4-dien-2-amine |
| SMILES | C=C(NCC)C(/C=C(\C)F)=C/C |
| InChI | InChI=1S/C10H16FN/c1-5-10(7-8(3)11)9(4)12-6-2/h5,7,12H,4,6H2,1-3H3/b8-7+,10-5+ |
| InChIKey | BBVWAXSWRWPKJJ-LZIZUESTSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|