C10H18N2 — CID 59886162
N,4-dimethyl-6-methyliminohepta-2,4-dien-2-amine (PubChem CID 59886162) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N,4-dimethyl-6-methyliminohepta-2,4-dien-2-amine.
| Compound Name | N,4-dimethyl-6-methyliminohepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 59886162 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N,4-dimethyl-6-methyliminohepta-2,4-dien-2-amine |
| SMILES | C/N=C(\C)C=C(C)C=C(C)NC |
| InChI | InChI=1S/C10H18N2/c1-8(6-9(2)11-4)7-10(3)12-5/h6-7,11H,1-5H3/b8-7?,9-6?,12-10+ |
| InChIKey | RVWZHRQGNSYTJQ-OEZRMVIGSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|