C15H19FN2 — CID 138713182
(2E,4E)-N-[(1E,3Z)-2-ethenyl-5-methyliminopenta-1,3-dienyl]-4-fluorohepta-2,4,6-trien-2-amine (PubChem CID 138713182) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is (2E,4E)-N-[(1E,3Z)-2-ethenyl-5-methyliminopenta-1,3-dienyl]-4-fluorohepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-N-[(1E,3Z)-2-ethenyl-5-methyliminopenta-1,3-dienyl]-4-fluorohepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 138713182 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2E,4E)-N-[(1E,3Z)-2-ethenyl-5-methyliminopenta-1,3-dienyl]-4-fluorohepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C(F)\C=C(/C)N/C=C(C=C)/C=C\C=N\C |
| InChI | InChI=1S/C15H19FN2/c1-5-8-15(16)11-13(3)18-12-14(6-2)9-7-10-17-4/h5-12,18H,1-2H2,3-4H3/b9-7-,13-11+,14-12+,15-8+,17-10+ |
| InChIKey | JBIZBFOAFGCHOG-QSRGLIOHSA-N |
| XLogP | 3.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|