C15H23FN2 — CID 145145037
(3E,5E)-N-[(Z)-2-(ethylideneamino)-4-methylpent-2-enyl]-5-fluorohepta-1,3,5-trien-3-amine (PubChem CID 145145037) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is (3E,5E)-N-[(Z)-2-(ethylideneamino)-4-methylpent-2-enyl]-5-fluorohepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-N-[(Z)-2-(ethylideneamino)-4-methylpent-2-enyl]-5-fluorohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145145037 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (3E,5E)-N-[(Z)-2-(ethylideneamino)-4-methylpent-2-enyl]-5-fluorohepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(F)=C/C)NCC(=C/C(C)C)/N=C/C |
| InChI | InChI=1S/C15H23FN2/c1-6-13(16)10-14(7-2)18-11-15(17-8-3)9-12(4)5/h6-10,12,18H,2,11H2,1,3-5H3/b13-6+,14-10+,15-9-,17-8+ |
| InChIKey | OZICPAQFEOQTQC-BGPQRTEFSA-N |
| XLogP | 4.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|