C15H20N2 — CID 144509143
N-[(2Z)-2-(propylideneamino)penta-2,4-dienyl]cyclohepta-1,3,6-trien-1-amine (PubChem CID 144509143) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-[(2Z)-2-(propylideneamino)penta-2,4-dienyl]cyclohepta-1,3,6-trien-1-amine.
| Compound Name | N-[(2Z)-2-(propylideneamino)penta-2,4-dienyl]cyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 144509143 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-[(2Z)-2-(propylideneamino)penta-2,4-dienyl]cyclohepta-1,3,6-trien-1-amine |
| SMILES | C=C/C=C(CNC1=CC=CCC=C1)\N=C\CC |
| InChI | InChI=1S/C15H20N2/c1-3-9-15(16-12-4-2)13-17-14-10-7-5-6-8-11-14/h3,5,7-12,17H,1,4,6,13H2,2H3/b15-9-,16-12+ |
| InChIKey | IXIALZUKNFQWCA-NZWPRXBESA-N |
| XLogP | 3.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|