C10H14N2 — CID 123695228
3-methyl-6,7,8,9-tetrahydro-3H-pyrido[3,4-b]azepine (PubChem CID 123695228) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3-methyl-6,7,8,9-tetrahydro-3H-pyrido[3,4-b]azepine.
| Compound Name | 3-methyl-6,7,8,9-tetrahydro-3H-pyrido[3,4-b]azepine |
|---|---|
| PubChem CID | 123695228 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3-methyl-6,7,8,9-tetrahydro-3H-pyrido[3,4-b]azepine |
| SMILES | CC1C=CC2=C(CNCC2)N=C1 |
| InChI | InChI=1S/C10H14N2/c1-8-2-3-9-4-5-11-7-10(9)12-6-8/h2-3,6,8,11H,4-5,7H2,1H3 |
| InChIKey | YOFBURAMQPUSOA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |