C15H14N2 — CID 57230838
N-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1,3,5,8,10,12,14-heptaen-2-amine (PubChem CID 57230838) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is N-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1,3,5,8,10,12,14-heptaen-2-amine.
| Compound Name | N-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1,3,5,8,10,12,14-heptaen-2-amine |
|---|---|
| PubChem CID | 57230838 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N-methyl-5-azatricyclo[9.4.0.03,8]pentadeca-1,3,5,8,10,12,14-heptaen-2-amine |
| SMILES | CNC1=c2ccccc2=CC=C2CC=NC=C21 |
| InChI | InChI=1S/C15H14N2/c1-16-15-13-5-3-2-4-11(13)6-7-12-8-9-17-10-14(12)15/h2-7,9-10,16H,8H2,1H3 |
| InChIKey | BBVSHZCRIBAQFH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |