C11H14N2 — CID 69190056
2-ethenyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-d]azepine (PubChem CID 69190056) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-ethenyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-d]azepine.
| Compound Name | 2-ethenyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 69190056 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-ethenyl-2,3,4,5-tetrahydro-1H-pyrido[2,3-d]azepine |
| SMILES | C=CC1CCC2=C(C=CN=CC2)N1 |
| InChI | InChI=1S/C11H14N2/c1-2-10-4-3-9-5-7-12-8-6-11(9)13-10/h2,6-8,10,13H,1,3-5H2 |
| InChIKey | KVJUFACMOPYTJS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|