About 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine
2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine (PubChem CID 68653775) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine |
| PubChem CID | 68653775 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine |
| SMILES | C1=CNC(C2=CCN=CC2)C=C1 |
| InChI | InChI=1S/C10H12N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h1-4,6,8,10,12H,5,7H2 |
| InChIKey | IBCHNUNKKJXHQN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine (CID 68653775) is 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine is C1=CNC(C2=CCN=CC2)C=C1.
What is the InChIKey of 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine?
The InChIKey is IBCHNUNKKJXHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h1-4,6,8,10,12H,5,7H2.
What are the key properties of 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine?
2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine has a molecular weight of 160.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydropyridin-4-yl)-1,2-dihydropyridine is sourced from PubChem (CID 68653775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).