C11H13N2+ — CID 58669499
8-aza-1-azoniatricyclo[8.3.0.03,7]trideca-1(13),3(7),5,10-tetraene (PubChem CID 58669499) has the molecular formula C11H13N2+ and a molecular weight of 173.24 g/mol. Its IUPAC name is 8-aza-1-azoniatricyclo[8.3.0.03,7]trideca-1(13),3(7),5,10-tetraene.
| Compound Name | 8-aza-1-azoniatricyclo[8.3.0.03,7]trideca-1(13),3(7),5,10-tetraene |
|---|---|
| PubChem CID | 58669499 |
| Molecular Formula | C11H13N2+ |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 8-aza-1-azoniatricyclo[8.3.0.03,7]trideca-1(13),3(7),5,10-tetraene |
| SMILES | C1=CC2=C(C1)C[N+]1=CCC=C1CN2 |
| InChI | InChI=1S/C11H13N2/c1-3-9-8-13-6-2-4-10(13)7-12-11(9)5-1/h1,4-6,12H,2-3,7-8H2/q+1 |
| InChIKey | FZOWBCUGBBYNJV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|