C8H8N2 — CID 56997363
1,7-dihydropyrrolo[3,2-c]azepine (PubChem CID 56997363) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,7-dihydropyrrolo[3,2-c]azepine.
| Compound Name | 1,7-dihydropyrrolo[3,2-c]azepine |
|---|---|
| PubChem CID | 56997363 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,7-dihydropyrrolo[3,2-c]azepine |
| SMILES | C1=NC=c2cc[nH]c2=CC1 |
| InChI | InChI=1S/C8H8N2/c1-2-8-7(3-5-10-8)6-9-4-1/h2-6,10H,1H2 |
| InChIKey | IOUHFKGJRGOQSC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |