C9H12N2 — CID 90804015
2,3,5a,9a-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 90804015) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,3,5a,9a-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 2,3,5a,9a-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 90804015 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,3,5a,9a-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | C1=CC2N=CCCNC2C=C1 |
| InChI | InChI=1S/C9H12N2/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-2,4-6,8-9,11H,3,7H2 |
| InChIKey | TWPJUPLTGZSUEP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |