C9H10N2S — CID 91376236
1,3,5a,9a-tetrahydro-1,5-benzodiazepine-2-thione (PubChem CID 91376236) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 1,3,5a,9a-tetrahydro-1,5-benzodiazepine-2-thione.
| Compound Name | 1,3,5a,9a-tetrahydro-1,5-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 91376236 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1,3,5a,9a-tetrahydro-1,5-benzodiazepine-2-thione |
| SMILES | S=C1CC=NC2C=CC=CC2N1 |
| InChI | InChI=1S/C9H10N2S/c12-9-5-6-10-7-3-1-2-4-8(7)11-9/h1-4,6-8H,5H2,(H,11,12) |
| InChIKey | SJFRRZRZKSQGFJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|