C8H10N2 — CID 91805170
(8aS)-1,2,4a,8a-tetrahydroquinoxaline (PubChem CID 91805170) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (8aS)-1,2,4a,8a-tetrahydroquinoxaline.
| Compound Name | (8aS)-1,2,4a,8a-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 91805170 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (8aS)-1,2,4a,8a-tetrahydroquinoxaline |
| SMILES | C1=CC2N=CCN[C@H]2C=C1 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-5,7-8,10H,6H2/t7?,8-/m0/s1 |
| InChIKey | QEHOBCWYWXBMJU-MQWKRIRWSA-N |
| XLogP | 0.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |